dimethyl 3-methylglutarate


dimethyl 3-methylglutarate, dimethyl 3-methylpentanedioate, methyl b-methylglutarate
Links:📏 NIST, ⚗️ ChemSynthesis
CAS:[19013-37-7]
Formula:C8H14O4; 174.20 g/mol
InChiKey:YIJLMTNDXYVGPQ-UHFFFAOYSA-N
SMILES:COC(=O)CC(C)CC(=O)OC
Molecular structure of dimethyl 3-methylglutarate
Density:1.052 g/mL
Molar volume:165.5 mL/mol
Refractive index:1.429
Molecular refractive power:42.67 mL/mol
Surface tension:33.77 dyn/cm

Isomers

(2R,3S)-2,3-diethylsuccinic acid
Molecular structure of (2R,3S)-2,3-diethylsuccinic acid
1,4-diacetoxybutane
Molecular structure of 1,4-diacetoxybutane
2,2,3,3-tetramethylbutanedioic acid
Molecular structure of 2,2,3,3-tetramethylbutanedioic acid
2,2-diethylbutanedioic acid
Molecular structure of 2,2-diethylbutanedioic acid
2,5-dihydroperoxy-2,5-dimethylhex-3-yne
Molecular structure of 2,5-dihydroperoxy-2,5-dimethylhex-3-yne
2-(3-methylbutyl)propanedioic acid
Molecular structure of 2-(3-methylbutyl)propanedioic acid
2-acetoxyethyl butanoate
Molecular structure of 2-acetoxyethyl butanoate
2-ethyl-2-propylpropanedioic acid
Molecular structure of 2-ethyl-2-propylpropanedioic acid
2-[4-(2-hydroxyethoxy)but-2-ynoxy]ethanol
Molecular structure of 2-[4-(2-hydroxyethoxy)but-2-ynoxy]ethanol
3-ethyl-3-methylpentanedioic acid
Molecular structure of 3-ethyl-3-methylpentanedioic acid
3-isopropylglutaric acid
Molecular structure of 3-isopropylglutaric acid
3-propylpentanedioic acid
Molecular structure of 3-propylpentanedioic acid
butyl hydrogen butanedioate
Molecular structure of butyl hydrogen butanedioate
diethyl 2-methylpropanedioate
Molecular structure of diethyl 2-methylpropanedioate
diethyl butanedioate
Molecular structure of diethyl butanedioate
diisopropyl oxalate
Molecular structure of diisopropyl oxalate
dimethyl (2R,3S)-2,3-dimethylbutanedioate
Molecular structure of dimethyl (2R,3S)-2,3-dimethylbutanedioate
dimethyl 2-methylpentanedioate
Molecular structure of dimethyl 2-methylpentanedioate
dimethyl 3-methylglutarate
Molecular structure of dimethyl 3-methylglutarate
dimethyl d,l-2,3-dimethylsuccinate
Molecular structure of dimethyl d,l-2,3-dimethylsuccinate
dimethyl hexanedioate
Molecular structure of dimethyl hexanedioate
dimethyl methylethylpropanedioate
Molecular structure of dimethyl methylethylpropanedioate
dimethyl n-propylmalonate
Molecular structure of dimethyl n-propylmalonate
dipropyl oxalate
Molecular structure of dipropyl oxalate
ethyl (2-methyl-1,3-dioxolan-2-yl)acetate
Molecular structure of ethyl (2-methyl-1,3-dioxolan-2-yl)acetate
ethyl hydrogen hexanedioate
Molecular structure of ethyl hydrogen hexanedioate
ethylene glycol dipropionate
Molecular structure of ethylene glycol dipropionate
hydrogen mono-tert-butyl succinate
Molecular structure of hydrogen mono-tert-butyl succinate
isosorbide dimethyl ether
Molecular structure of isosorbide dimethyl ether
methyl (4R,5S)-2,2,5-trimethyl-1,3-dioxolane-4-carboxylate
Molecular structure of methyl (4R,5S)-2,2,5-trimethyl-1,3-dioxolane-4-carboxylate
octanedioic acid
Molecular structure of octanedioic acid
pentylmalonic acid
Molecular structure of pentylmalonic acid
propyl 2-acetyloxypropanoate
Molecular structure of propyl 2-acetyloxypropanoate
quetol 651
Molecular structure of quetol 651
rac-2,3-diethylsuccinic acid
Molecular structure of rac-2,3-diethylsuccinic acid
tert-butyl methyl malonate
Molecular structure of tert-butyl methyl malonate