dimethyl hexanedioate


dimethyl adipate; dimethyl hexanedioate; DMA; hexanedioic acid dimethyl ester; methyl adipate
Links:📏 NIST, ⚗️ ChemSynthesis, 📖 PubMed
CAS RN:[627-93-0]
Formula:C8H14O4; 174.20 g/mol
InChiKey:UDSFAEKRVUSQDD-UHFFFAOYSA-N
SMILES:O=C(OC)CCCCC(=O)OC
Molecular structure of dimethyl hexanedioate
Density:1.063 g/mL
Molar volume:163.9 mL/mol
Refractive index:1.428
Molecular refractive power:42.18 mL/mol
Melting point:11 °C
Surface tension:35.66 dyn/cm
Log10 partition octanol / water:1.03
Hansen solubility parameter:δd: 8.3 (cal/mL)½   δp: 2.1 (cal/mL)½   δh: 4.5 (cal/mL)½

Isomers

2-acetoxyethyl butanoate
Molecular structure of 2-acetoxyethyl butanoate
butyl hydrogen butanedioate
Molecular structure of butyl hydrogen butanedioate
tert-butyl methyl malonate
Molecular structure of tert-butyl methyl malonate
1,4-diacetoxybutane
Molecular structure of 1,4-diacetoxybutane
(R,S)-2,3-diacetoxybutane
Molecular structure of (R,S)-2,3-diacetoxybutane
2,3-diacetoxybutane
Molecular structure of 2,3-diacetoxybutane
diethyl butanedioate
Molecular structure of diethyl butanedioate
2,2-diethylbutanedioic acid
Molecular structure of 2,2-diethylbutanedioic acid
diethyl 2-methylpropanedioate
Molecular structure of diethyl 2-methylpropanedioate
(2R,3S)-2,3-diethylsuccinic acid
Molecular structure of (2R,3S)-2,3-diethylsuccinic acid
rac-2,3-diethylsuccinic acid
Molecular structure of rac-2,3-diethylsuccinic acid
2,5-dihydroperoxy-2,5-dimethylhex-3-yne
Molecular structure of 2,5-dihydroperoxy-2,5-dimethylhex-3-yne
diisopropyl oxalate
Molecular structure of diisopropyl oxalate
dimethyl (2R,3S)-2,3-dimethylbutanedioate
Molecular structure of dimethyl (2R,3S)-2,3-dimethylbutanedioate
dimethyl δ,λ-2,3-dimethylsuccinate
Molecular structure of dimethyl d,l-2,3-dimethylsuccinate
dimethyl hexanedioate
Molecular structure of dimethyl hexanedioate
dimethyl methylethylpropanedioate
Molecular structure of dimethyl methylethylpropanedioate
dimethyl 3-methylglutarate
Molecular structure of dimethyl 3-methylglutarate
dimethyl 2-methylpentanedioate
Molecular structure of dimethyl 2-methylpentanedioate
dimethyl n-propylmalonate
Molecular structure of dimethyl n-propylmalonate
dipropyl oxalate
Molecular structure of dipropyl oxalate
ethylene glycol dipropionate
Molecular structure of ethylene glycol dipropionate
ethyl hydrogen hexanedioate
Molecular structure of ethyl hydrogen hexanedioate
ethyl (2-methyl-1,3-dioxolan-2-yl)acetate
Molecular structure of ethyl (2-methyl-1,3-dioxolan-2-yl)acetate
3-ethyl-3-methylpentanedioic acid
Molecular structure of 3-ethyl-3-methylpentanedioic acid
2-ethyl-2-propylpropanedioic acid
Molecular structure of 2-ethyl-2-propylpropanedioic acid
hydrogen mono-tert-butyl succinate
Molecular structure of hydrogen mono-tert-butyl succinate
2-[4-(2-hydroxyethoxy)but-2-ynoxy]ethanol
Molecular structure of 2-[4-(2-hydroxyethoxy)but-2-ynoxy]ethanol
3-isopropylglutaric acid
Molecular structure of 3-isopropylglutaric acid
isosorbide dimethyl ether
Molecular structure of isosorbide dimethyl ether
2-(3-methylbutyl)propanedioic acid
Molecular structure of 2-(3-methylbutyl)propanedioic acid
methyl (4R,5S)-2,2,5-trimethyl-1,3-dioxolane-4-carboxylate
Molecular structure of methyl (4R,5S)-2,2,5-trimethyl-1,3-dioxolane-4-carboxylate
octanedioic acid
Molecular structure of octanedioic acid
pentylmalonic acid
Molecular structure of pentylmalonic acid
propyl 2-acetyloxypropanoate
Molecular structure of propyl 2-acetyloxypropanoate
3-propylpentanedioic acid
Molecular structure of 3-propylpentanedioic acid
quetol 651
Molecular structure of quetol 651
2,2,3,3-tetramethylbutanedioic acid
Molecular structure of 2,2,3,3-tetramethylbutanedioic acid