(E)-4-methyl-2-propenylphenol


(E)-4-methyl-2-propenylphenol; o-propenyl-p-cresol
Formula:C10H12O; 148.20 g/mol
InChiKey:WPHPAOKIUGOXMM-ONEGZZNKSA-N
SMILES:C/C=C/c1cc(C)ccc1O
Molecular structure of (E)-4-methyl-2-propenylphenol
Density:1.029 g/mL
Molar volume:144.0 mL/mol
Refractive index:1.578
Molecular refractive power:47.77 mL/mol

Isomers

allyl benzyl ether
Molecular structure of allyl benzyl ether
1-allyl-2-methoxybenzene
Molecular structure of 1-allyl-2-methoxybenzene
1-allyl-4-methoxybenzene
Molecular structure of 1-allyl-4-methoxybenzene
2-allyl-4-methylphenol
Molecular structure of 2-allyl-4-methylphenol
2-allyl-6-methylphenol
Molecular structure of 2-allyl-6-methylphenol
1-allyloxy-2-methylbenzene
Molecular structure of 1-allyloxy-2-methylbenzene
cyclopropyl-phenylmethanol
Molecular structure of cyclopropyl-phenylmethanol
2,4-dimethylacetophenone
Molecular structure of 2,4-dimethylacetophenone
2,5-dimethylacetophenone
Molecular structure of 2,5-dimethylacetophenone
2',5'-dimethylacetophenone
Molecular structure of 2',5'-dimethylacetophenone
3',4'-dimethylacetophenone
Molecular structure of 3',4'-dimethylacetophenone
3',5'-dimethylacetophenone
Molecular structure of 3',5'-dimethylacetophenone
1-ethenyl-4-ethoxybenzene
Molecular structure of 1-ethenyl-4-ethoxybenzene
1-ethoxy-1-phenylethene
Molecular structure of 1-ethoxy-1-phenylethene
(E)-1-ethoxy-2-phenylethene
Molecular structure of (E)-1-ethoxy-2-phenylethene
4-ethoxystyrene
Molecular structure of 4-ethoxystyrene
3-ethylacetophenone
Molecular structure of 3-ethylacetophenone
2-(4-ethylphenyl)acetaldehyde
Molecular structure of 2-(4-ethylphenyl)acetaldehyde
1-(4-ethylphenyl)ethanone
Molecular structure of 1-(4-ethylphenyl)ethanone
1-(4-ethylphenyl)ethanone
Molecular structure of 1-(4-ethylphenyl)ethanone
4-isopropylbenzaldehyde
Molecular structure of 4-isopropylbenzaldehyde
methallyl phenyl ether
Molecular structure of methallyl phenyl ether
(E)-1-methoxy-2-propenylbenzene
Molecular structure of (E)-1-methoxy-2-propenylbenzene
1-methoxy-2-(propen-2-yl)benzene
Molecular structure of 1-methoxy-2-(propen-2-yl)benzene
1-methoxy-3-(propen-2-yl)benzene
Molecular structure of 1-methoxy-3-(propen-2-yl)benzene
(E)-1-methoxy-4-(1-propenyl)benzene
Molecular structure of (E)-1-methoxy-4-(1-propenyl)benzene
1-methoxy-4-[(1E)-prop-1-en-1-yl]benzene
Molecular structure of 1-methoxy-4-[(1E)-prop-1-en-1-yl]benzene
1-methoxy-4-prop-1-en-2-ylbenzene
Molecular structure of 1-methoxy-4-prop-1-en-2-ylbenzene
[(1E)-3-methoxy-1-propenyl]benzene
Molecular structure of [(1E)-3-methoxy-1-propenyl]benzene
5-methyl-3,4-dihydro-2H-chromene
Molecular structure of 5-methyl-3,4-dihydro-2H-chromene
p-methylhydratropaldehyde
Molecular structure of p-methylhydratropaldehyde
7-methyl-4-indanol
Molecular structure of 7-methyl-4-indanol
2-methyl-3-phenylpropanal
Molecular structure of 2-methyl-3-phenylpropanal
3-(4-methylphenyl)propanal
Molecular structure of 3-(4-methylphenyl)propanal
1-(4-methylphenyl)-1-propanone
Molecular structure of 1-(4-methylphenyl)-1-propanone
2-methyl-1-phenyl-1-propanone
Molecular structure of 2-methyl-1-phenyl-1-propanone
(E)-4-methyl-2-propenylphenol
Molecular structure of (E)-4-methyl-2-propenylphenol
4-methyl-2-(propen-2-yl)phenol
Molecular structure of 4-methyl-2-(propen-2-yl)phenol
3-phenylbutanal
Molecular structure of 3-phenylbutanal
1-phenyl-1-butanone
Molecular structure of 1-phenyl-1-butanone
1-phenyl-2-butanone
Molecular structure of 1-phenyl-2-butanone
4-phenyl-2-butanone
Molecular structure of 4-phenyl-2-butanone
4-phenyl-1-buten-4-ol
Molecular structure of 4-phenyl-1-buten-4-ol
4-propylbenzaldehyde
Molecular structure of 4-propylbenzaldehyde
(R)-(-)-1,2,3,4-tetrahydro-1-naphthol
Molecular structure of (R)-(-)-1,2,3,4-tetrahydro-1-naphthol
(S)-(+)-1,2,3,4-tetrahydro-1-naphthol
Molecular structure of (S)-(+)-1,2,3,4-tetrahydro-1-naphthol
1,2,3,4-tetrahydro-1-naphthol
Molecular structure of 1,2,3,4-tetrahydro-1-naphthol
1,2,3,4-tetrahydro-2-naphthol
Molecular structure of 1,2,3,4-tetrahydro-2-naphthol
5,6,7,8-tetrahydro-1-naphthol
Molecular structure of 5,6,7,8-tetrahydro-1-naphthol
5,6,7,8-tetrahydro-2-naphthol
Molecular structure of 5,6,7,8-tetrahydro-2-naphthol
2,4,5-trimethylbenzaldehyde
Molecular structure of 2,4,5-trimethylbenzaldehyde
2,4,6-trimethylbenzaldehyde
Molecular structure of 2,4,6-trimethylbenzaldehyde
2,4,5-trimethyl-6-methylenecyclohexa-2,4-dienone
Molecular structure of 2,4,5-trimethyl-6-methylenecyclohexa-2,4-dienone