vinylsilatrane


5-ethenyl-4,6,11-trioxa-1-aza-5-silabicyclo[3.3.3]undecane; vinylsilatrane
Links:📏 NIST, 🕷 ChemSpider
CAS:[2097-18-9]
Formula:C8H15NO3Si; 201.30 g/mol
InChiKey:JETUZEFHWCTPQD-UHFFFAOYSA-N
SMILES:C=C[Si]12OCCN(CCO1)CCO2
Molecular structure of vinylsilatrane
Dipole moment:5.88 D