undecafluorocyclohexane


1H-perfluorocyclohexane; undecafluorocyclohexane; 1H-undecafluorocyclohexane; 1,1,2,2,3,3,4,4,5,5,6-undecafluorocyclohexane
Links:📏 NIST
CAS:[308-24-7]
Formula:C6HF11; 282.06 g/mol
InChiKey:AWQSRASHARXGAH-UHFFFAOYSA-N
SMILES:FC1C(F)(F)C(F)(F)C(F)(F)C(F)(F)C1(F)F
Molecular structure of undecafluorocyclohexane
Dipole moment:1.64 D
Critical temperature:205 °C