trisilylamine


trisilylamine
CAS:[13862-16-3]
Formula:H9NSi3; 107.33 g/mol
InChiKey:VOSJXMPCFODQAR-UHFFFAOYSA-N
SMILES:[SiH3]N([SiH3])[SiH3]
Molecular structure of trisilylamine
Dipole moment:0.00 D