tris(dimethylamino)phosphine


hexamethylphosphoroustriamide; hexamethyltriaminophosphine; tris(dimethylamino)phosphine
Links:📏 NIST, 📖 PubMed
CAS:[1608-26-0]
Formula:C6H18N3P; 163.20 g/mol
InChiKey:XVDBWWRIXBMVJV-UHFFFAOYSA-N
SMILES:CN(C)P(N(C)C)N(C)C
Molecular structure of tris(dimethylamino)phosphine
Density:0.900 g/mL
Molar volume:181.3 mL/mol
Dipole moment:1.42 D
Melting point:-44 °C