tris(4-nitrophenyl)methane


1-[bis(4-nitrophenyl)methyl]-4-nitrobenzene; tri-p-nitrophenylmethane; 4,4',4"-trinitrotriphenylmethane; tris(4-nitrophenyl)methane
Links:📏 NIST, 🕷 ChemSpider
CAS:[603-49-6]
Formula:C19H13N3O6; 379.33 g/mol
InChiKey:GFDFIMKBMBRKCK-UHFFFAOYSA-N
SMILES:[O-][N+](=O)c1ccc(cc1)C(c2ccc(cc2)[N+]([O-])=O)c3ccc(cc3)[N+]([O-])=O
Molecular structure of tris(4-nitrophenyl)methane
Dipole moment:3.23 D
Melting point:206 °C