tris(4-methylphenyl)phosphane


tris(4-methylphenyl)phosphane; tris(4-methylphenyl)phosphine; tris(p-tolyl)phosphine; tri(p-tolyl)phosphine
CAS:[1038-95-5]
Formula:C21H21P; 304.37 g/mol
InChiKey:WXAZIUYTQHYBFW-UHFFFAOYSA-N
SMILES:Cc1ccc(cc1)P(c2ccc(C)cc2)c3ccc(C)cc3
Molecular structure of tris(4-methylphenyl)phosphane
Dipole moment:1.96 D
Melting point:145 °C

Isomers

tribenzylphosphine
Molecular structure of tribenzylphosphine
tris(3-methylphenyl)phosphane
Molecular structure of tris(3-methylphenyl)phosphane
tris(4-methylphenyl)phosphane
Molecular structure of tris(4-methylphenyl)phosphane
tris(2-methylphenyl)phosphine
Molecular structure of tris(2-methylphenyl)phosphine