tris(4-methylphenyl) phosphite


tri-p-cresyl phosphite; tris(4-methylphenyl) phosphite; p-tritolyl phosphite; tri-p-tolyl phosphite; tri-p-tolylphosphite
CAS:[620-42-8]
Formula:C21H21O3P; 352.37 g/mol
InChiKey:FEVFLQDDNUQKRY-UHFFFAOYSA-N
SMILES:Cc1ccc(OP(Oc2ccc(C)cc2)Oc3ccc(C)cc3)cc1
Molecular structure of tris(4-methylphenyl) phosphite
Dipole moment:1.77 D

Isomers

tris(2-methoxyphenyl)phosphine
Molecular structure of tris(2-methoxyphenyl)phosphine
tris(3-methoxyphenyl)phosphine
Molecular structure of tris(3-methoxyphenyl)phosphine
tris(4-methoxyphenyl)phosphine
Molecular structure of tris(4-methoxyphenyl)phosphine
tris(2-methylphenyl) phosphite
Molecular structure of tris(2-methylphenyl) phosphite
tris(3-methylphenyl) phosphite
Molecular structure of tris(3-methylphenyl) phosphite
tris(4-methylphenyl) phosphite
Molecular structure of tris(4-methylphenyl) phosphite