tris(4-chlorophenyl)phosphine


tris(4-chlorophenyl)phosphine
CAS:[1159-54-2]
Formula:C18H12Cl3P; 365.63 g/mol
InChiKey:IQKSLJOIKWOGIZ-UHFFFAOYSA-N
SMILES:Clc1ccc(cc1)P(c2ccc(Cl)cc2)c3ccc(Cl)cc3
Molecular structure of tris(4-chlorophenyl)phosphine
Dipole moment:0.65 D
Melting point:103 °C

Isomers

tris(3-chlorophenyl)phosphine
Molecular structure of tris(3-chlorophenyl)phosphine
tris(4-chlorophenyl)phosphine
Molecular structure of tris(4-chlorophenyl)phosphine