tris(3-methylphenyl) phosphite


tri-m-cresyl phosphite; tris(3-methylphenyl) phosphite; m-tritolyl phosphite; tri-m-tolyl phosphite; tri-m-tolylphosphite
CAS:[563-04-2]
Formula:C21H21O3P; 352.37 g/mol
InChiKey:AZLGDNBTDKZORI-UHFFFAOYSA-N
SMILES:Cc1cccc(OP(Oc2cccc(C)c2)Oc3cccc(C)c3)c1
Molecular structure of tris(3-methylphenyl) phosphite
Dipole moment:1.62 D

Isomers

tris(2-methoxyphenyl)phosphine
Molecular structure of tris(2-methoxyphenyl)phosphine
tris(3-methoxyphenyl)phosphine
Molecular structure of tris(3-methoxyphenyl)phosphine
tris(4-methoxyphenyl)phosphine
Molecular structure of tris(4-methoxyphenyl)phosphine
tris(2-methylphenyl) phosphite
Molecular structure of tris(2-methylphenyl) phosphite
tris(3-methylphenyl) phosphite
Molecular structure of tris(3-methylphenyl) phosphite
tris(4-methylphenyl) phosphite
Molecular structure of tris(4-methylphenyl) phosphite