tris(3-fluorophenyl)phosphine


tris(3-fluorophenyl)phosphine
CAS:[23039-94-3]
Formula:C18H12F3P; 316.26 g/mol
InChiKey:CUTRINLXFPIWQB-UHFFFAOYSA-N
SMILES:Fc1cccc(c1)P(c2cccc(F)c2)c3cccc(F)c3
Molecular structure of tris(3-fluorophenyl)phosphine
Dipole moment:2.32 D
Melting point:62 °C

Isomers

bis(3-fluorophenyl)-4-fluorophenylphosphine
Molecular structure of bis(3-fluorophenyl)-4-fluorophenylphosphine
3-fluorophenyl-bis(4-fluorophenyl)phosphine
Molecular structure of 3-fluorophenyl-bis(4-fluorophenyl)phosphine
tris(3-fluorophenyl)phosphine
Molecular structure of tris(3-fluorophenyl)phosphine
tris(4-fluorophenyl)phosphine
Molecular structure of tris(4-fluorophenyl)phosphine