tris(3-chlorophenyl)phosphine


tris(3-chlorophenyl)phosphine
CAS:[29949-85-7]
Formula:C18H12Cl3P; 365.63 g/mol
InChiKey:QAPGHLJQIVDTPT-UHFFFAOYSA-N
SMILES:Clc1cccc(c1)P(c2cccc(Cl)c2)c3cccc(Cl)c3
Molecular structure of tris(3-chlorophenyl)phosphine
Dipole moment:2.53 D
Melting point:65 °C

Isomers

tris(3-chlorophenyl)phosphine
Molecular structure of tris(3-chlorophenyl)phosphine
tris(4-chlorophenyl)phosphine
Molecular structure of tris(4-chlorophenyl)phosphine