tripropylphosphine oxide


tri-n-propylphosphine oxide; tripropylphosphine oxide
Links:📏 NIST
CAS:[1496-94-2]
Formula:C9H21OP; 176.24 g/mol
InChiKey:SNZSAFILJOCMFM-UHFFFAOYSA-N
SMILES:CCC[P](=O)(CCC)CCC
Molecular structure of tripropylphosphine oxide
Dipole moment:4.36 D
Melting point:39 °C