triphenylstibane


triphenylantimony(III); triphenylstibane; triphenylstibene
CAS:[603-36-1]
Formula:C18H15Sb; 353.08 g/mol
InChiKey:HVYVMSPIJIWUNA-UHFFFAOYSA-N
SMILES:c1ccc(cc1)[Sb](c2ccccc2)c3ccccc3
Molecular structure of triphenylstibane
Dipole moment:0.57 D
Melting point:53 °C
Boiling point:377 °C