triphenylsilane


triphenylsilane
Links:📖 PubMed
CAS:[789-25-3]
Formula:C18H16Si; 260.41 g/mol
InChiKey:AKQNYQDSIDKVJZ-UHFFFAOYSA-N
SMILES:c1ccc(cc1)[SiH](c2ccccc2)c3ccccc3
Molecular structure of triphenylsilane
Dipole moment:0.70 D
Melting point:43 °C