triphenylphosphine sulfide


triphenylphosphine sulfide
Links:⚗️ ChemSynthesis, 📖 PubMed
CAS:[3878-45-3]
Formula:C18H15PS; 294.36 g/mol
InChiKey:VYNGFCUGSYEOOZ-UHFFFAOYSA-N
SMILES:S=[P](c1ccccc1)(c2ccccc2)c3ccccc3
Molecular structure of triphenylphosphine sulfide
Dipole moment:4.88 D
Melting point:161 °C