triphenylphosphine


triphenylphosphane; triphenylphosphine
Links:📏 NIST, ⚗️ ChemSynthesis, 📖 PubMed
CAS:[603-35-0]
Formula:C18H15P; 262.29 g/mol
InChiKey:RIOQSEWOXXDEQQ-UHFFFAOYSA-N
SMILES:c1ccc(cc1)P(c2ccccc2)c3ccccc3
Molecular structure of triphenylphosphine
Density:1.200 g/mL
Molar volume:218.6 mL/mol
Dipole moment:1.49 D
Melting point:80 °C
Boiling point:377 °C
Critical pressure:7.8 atm
Log10 partition octanol / water:5.69