triphenylmethanol


triphenylcarbinol; triphenylmethanol; tritanol; zidovudine impurity D
Links:🌍 Wikipedia, 📏 NIST, ⚗️ ChemSynthesis, 📖 PubMed
CAS:[76-84-6]
Formula:C19H16O; 260.34 g/mol
InChiKey:LZTRCELOJRDYMQ-UHFFFAOYSA-N
SMILES:OC(c1ccccc1)(c2ccccc2)c3ccccc3
Molecular structure of triphenylmethanol
Dipole moment:2.11 D
Melting point:163 °C
Boiling point:380 °C
Log10 partition octanol / water:3.68

Isomers

(2E,5E)-2,5-bis(phenylmethylidene)cyclopentan-1-one
Molecular structure of (2E,5E)-2,5-bis(phenylmethylidene)cyclopentan-1-one
1,7-diphenyl-2,4,6-heptatrien-1-one
Molecular structure of 1,7-diphenyl-2,4,6-heptatrien-1-one
7-(phenylethynyl)-7-(prop-2-en-1-yloxy)bicyclo[4.2.0]octa-1,3,5-triene
Molecular structure of 7-(phenylethynyl)-7-(prop-2-en-1-yloxy)bicyclo[4.2.0]octa-1,3,5-triene
triphenylmethanol
Molecular structure of triphenylmethanol