triphenylamine


N,N-di(phenyl)aniline; N,N-diphenylaniline; triphenylamine
Links:📖 PubMed
CAS:[603-34-9]
Formula:C18H15N; 245.32 g/mol
InChiKey:ODHXBMXNKOYIBV-UHFFFAOYSA-N
SMILES:c1ccc(cc1)N(c2ccccc2)c3ccccc3
Molecular structure of triphenylamine
Density:0.774 g/mL
Molar volume:317.0 mL/mol
Dipole moment:0.26 D
Melting point:127 °C
Boiling point:365 °C
Log10 partition octanol / water:5.74

Isomers

11-cyano-11-methyl-9,10-dihydro-9,10-ethanoanthracene
Molecular structure of 11-cyano-11-methyl-9,10-dihydro-9,10-ethanoanthracene
2,6-diphenylaniline
Molecular structure of 2,6-diphenylaniline
diphenyl-4-pyridylmethane
Molecular structure of diphenyl-4-pyridylmethane
triphenylamine
Molecular structure of triphenylamine