triphenyl phosphite


phenyl phosphite; triphenyl phosphite
Links:📏 NIST, 📖 PubMed
CAS:[101-02-0]
Formula:C18H15O3P; 310.29 g/mol
InChiKey:HVLLSGMXQDNUAL-UHFFFAOYSA-N
SMILES:O(P(Oc1ccccc1)Oc2ccccc2)c3ccccc3
Molecular structure of triphenyl phosphite
Density:1.184 g/mL
Molar volume:262.1 mL/mol
Dipole moment:1.46 D
Melting point:23 °C
Boiling point:360 °C