triphenyl phosphate


triphenyl phosphate
Links:🌍 Wikipedia, 📏 NIST, 📖 PubMed
CAS:[115-86-6]
Formula:C18H15O4P; 326.29 g/mol
InChiKey:XZZNDPSIHUTMOC-UHFFFAOYSA-N
SMILES:O=[P](Oc1ccccc1)(Oc2ccccc2)Oc3ccccc3
Molecular structure of triphenyl phosphate
Dipole moment:2.97 D
Melting point:50 °C
Boiling point:414 °C
Log10 partition octanol / water:4.59