tripentylphosphine oxide


tri-n-amylphosphine oxide; triamylphosphine oxide; tri-n-pentylphosphine oxide; tripentylphosphine oxide
CAS:[3084-47-7]
Formula:C15H33OP; 260.40 g/mol
InChiKey:SAIZTOCXWYRRNW-UHFFFAOYSA-N
SMILES:CCCCC[P](=O)(CCCCC)CCCCC
Molecular structure of tripentylphosphine oxide
Dipole moment:4.35 D
Melting point:84 °C