trioctylphosphine oxide


tri(n-octyl)phosphine oxide; tri-n-octylphosphine oxide; trioctylphosphine oxide
Links:📖 PubMed
CAS:[78-50-2]
Formula:C24H51OP; 386.64 g/mol
InChiKey:ZMBHCYHQLYEYDV-UHFFFAOYSA-N
SMILES:CCCCCCCC[P](=O)(CCCCCCCC)CCCCCCCC
Molecular structure of trioctylphosphine oxide
Density:0.880 g/mL
Molar volume:439.4 mL/mol
Dipole moment:5.90 D
Melting point:55 °C