trinitromethane


nitroform; trinitromethane
Links:🕷 ChemSpider, 📖 PubMed
CAS:[517-25-9]
Formula:CHN3O6; 151.04 g/mol
InChiKey:LZGVDNRJCGPNDS-UHFFFAOYSA-N
SMILES:[O-][N+](=O)C([N+]([O-])=O)[N+]([O-])=O
Molecular structure of trinitromethane
Density:1.469 g/mL
Molar volume:102.8 mL/mol
Dipole moment:2.52 D
Melting point:25 °C