trimethylphenoxysilane


phenoxy(trimethyl)silane; phenyl trimethylsilyl ether; trimethyl(phenoxy)silane; trimethylphenoxysilane
Links:📏 NIST
CAS:[1529-17-5]
Formula:C9H14OSi; 166.30 g/mol
InChiKey:OJAJJFGMKAZGRZ-UHFFFAOYSA-N
SMILES:C[Si](C)(C)Oc1ccccc1
Molecular structure of trimethylphenoxysilane
Dielectric constant:3.40
Dipole moment:1.22 D
Melting point:-55 °C
Boiling point:119 °C