trimethyl-(2-methylpropoxy)silane


butan-2-yloxy(trimethyl)silane; sec-butoxy-trimethyl-silane; trimethyl-sec-butoxysilane; trimethyl-(2-methylpropoxy)silane
Links:📏 NIST
CAS:[1825-66-7]
Formula:C7H18OSi; 146.30 g/mol
InChiKey:ZQINJXJSYYRJIV-UHFFFAOYSA-N
SMILES:CC(C)CO[Si](C)(C)C
Molecular structure of trimethyl-(2-methylpropoxy)silane
Dielectric constant:2.72
Dipole moment:1.09 D

Isomers

butoxytrimethylsilane
Molecular structure of butoxytrimethylsilane
triethylmethoxysilane
Molecular structure of triethylmethoxysilane
trimethyl-[(2-methylpropan-2-yl)oxy]silane
Molecular structure of trimethyl-[(2-methylpropan-2-yl)oxy]silane
trimethyl-(2-methylpropoxy)silane
Molecular structure of trimethyl-(2-methylpropoxy)silane