trimethyl(phenylthio)silane


(phenylthio)trimethylsilane; trimethyl(phenylthio)silane
CAS:[4551-15-9]
Formula:C9H14SSi; 182.36 g/mol
InChiKey:VJMQFIRIMMSSRW-UHFFFAOYSA-N
SMILES:C[Si](C)(C)Sc1ccccc1
Molecular structure of trimethyl(phenylthio)silane
Density:0.965 g/mL
Molar volume:189.0 mL/mol
Refractive index:1.532
Molecular refractive power:58.56 mL/mol
Dipole moment:1.76 D