triethyltin acetate


acetoxytriethylstannane; triethyltin acetate
Links:📏 NIST
CAS:[1907-13-7]
Formula:C8H18O2Sn; 264.94 g/mol
InChiKey:WOUNUBHOYKWRNA-UHFFFAOYSA-M
SMILES:CC[Sn+](CC)CC.CC([O-])=O
Molecular structure of triethyltin acetate
Dipole moment:2.05 D