tert-butyl phosphonate

Home   ::   Tables for Chemistry   ::   Compound classes

tert-butyl phosphonate; di-tert-butyl phosphonate
Links:🕷 ChemSpider
Formula:C8H19O3P; 194.21 g/mol
InChiKey:HLMXUWAUCZMWOG-UHFFFAOYSA-N
SMILES:CC(C)(C)O[PH]([O-])=O
Molecular structure of tert-butyl phosphonate
Melting point:192 °C

Isomers

tert-butyl phosphonate
Molecular structure of tert-butyl phosphonate
dibutyl hydrogen phosphite
Molecular structure of dibutyl hydrogen phosphite
ditert-butyl hydrogen phosphite
Molecular structure of ditert-butyl hydrogen phosphite
octylphosphonic acid
Molecular structure of octylphosphonic acid
  ::     ::   Zla Mavka