lindane


γ-benzenehexachloride; γ-bhc; 1α,2α,3β,4α,5α,6β-hexachlorocyclohexane; γ-hexachlorocyclohexane; lindane
Links:🌍 Wikipedia, 📖 PubMed
MeSH:Insecticides; Pesticides
CAS:[58-89-9]
Formula:C6H6Cl6; 290.83 g/mol
InChiKey:JLYXXMFPNIAWKQ-UHFFFAOYSA-N
SMILES:C1C(C(C(C(C1Cl)Cl)Cl)Cl)ClCl
Molecular structure of lindane
Dipole moment:2.82 D
Melting point:113 °C
Boiling point:288 °C
Log10 partition octanol / water:3.72

Isomers

1α,2α,3α,4β,5α,6β-hexachlorocyclohexane
Molecular structure of 1a,2a,3a,4b,5a,6b-hexachlorocyclohexane
1α,2α,3β,4α,5β,6α-hexachlorocyclohexane
Molecular structure of 1a,2a,3b,4a,5b,6a-hexachlorocyclohexane
1α,2β,3α,4β,5α,6β-hexachlorocyclohexane
Molecular structure of 1a,2b,3a,4b,5a,6b-hexachlorocyclohexane
lindane
Molecular structure of lindane