furan-3-yl-phenylmethanone


3-benzoylfuran; furan-3-yl-phenylmethanone
Links:🕷 ChemSpider
Formula:C11H8O2; 172.18 g/mol
InChiKey:SEIJUEFSMOQNKS-UHFFFAOYSA-N
SMILES:O=C(c1cocc1)c2ccccc2
Molecular structure of furan-3-yl-phenylmethanone
Dipole moment:2.87 D

Isomers

azulene-1-carboxylic acid
Molecular structure of azulene-1-carboxylic acid
azulene-2-carboxylic acid
Molecular structure of azulene-2-carboxylic acid
azulene-5-carboxylic acid
Molecular structure of azulene-5-carboxylic acid
azulene-6-carboxylic acid
Molecular structure of azulene-6-carboxylic acid
bicyclo[4.4.1]undeca-1(10),3,5,8-tetraene-2,7-dione
Molecular structure of bicyclo[4.4.1]undeca-1(10),3,5,8-tetraene-2,7-dione
bicyclo[4.4.1]undeca-1,4,6,9-tetraene-3,8-dione
Molecular structure of bicyclo[4.4.1]undeca-1,4,6,9-tetraene-3,8-dione
furan-2-yl-phenylmethanone
Molecular structure of furan-2-yl-phenylmethanone
furan-3-yl-phenylmethanone
Molecular structure of furan-3-yl-phenylmethanone
2-hydroxy-1-naphthaldehyde
Molecular structure of 2-hydroxy-1-naphthaldehyde
4-hydroxy-1-naphthaldehyde
Molecular structure of 4-hydroxy-1-naphthaldehyde
6-methylnaphthalene-1,4-dione
Molecular structure of 6-methylnaphthalene-1,4-dione
2-methyl-1,4-naphthoquinone
Molecular structure of 2-methyl-1,4-naphthoquinone
1-naphthoic acid
Molecular structure of 1-naphthoic acid
2-naphthoic acid
Molecular structure of 2-naphthoic acid
5-phenyl-2-furaldehyde
Molecular structure of 5-phenyl-2-furaldehyde