ethyl quinoline-8-carboxylate


ethyl quinoline-8-carboxylate
Links:🕷 ChemSpider
Formula:C12H11NO2; 201.22 g/mol
InChiKey:WTLGTEPKKMWKPX-UHFFFAOYSA-N
SMILES:CCOC(=O)c1cccc2cccnc12
Molecular structure of ethyl quinoline-8-carboxylate
Dipole moment:3.31 D

Isomers

2-benzyloxy-3-hydroxypyridine
Molecular structure of 2-benzyloxy-3-hydroxypyridine
2-benzyloxy-5-hydroxypyridine
Molecular structure of 2-benzyloxy-5-hydroxypyridine
4-benzyloxy-2-hydroxypyridine
Molecular structure of 4-benzyloxy-2-hydroxypyridine
4-(benzyloxy)pyridine N-oxide
Molecular structure of 4-(benzyloxy)pyridine N-oxide
4-benzyloxypyridine 1-oxide
Molecular structure of 4-benzyloxypyridine 1-oxide
4-benzyloxy-2(1~H)-pyridone
Molecular structure of 4-benzyloxy-2(1H)-pyridone
carbaryl
Molecular structure of carbaryl
3-carboxylato-1-methylquinaldinium
Molecular structure of 3-carboxylato-1-methylquinaldinium
1,3-diacetylindole
Molecular structure of 1,3-diacetylindole
ethyl trans-α-cyanocinnamate
Molecular structure of ethyl trans-a-cyanocinnamate
1-(4-ethylphenyl)pyrrole-2,5-dione
Molecular structure of 1-(4-ethylphenyl)pyrrole-2,5-dione
ethyl 3-quinolinecarboxylate
Molecular structure of ethyl 3-quinolinecarboxylate
ethyl quinoline-8-carboxylate
Molecular structure of ethyl quinoline-8-carboxylate
1-ethylquinolinium-4-carboxylate
Molecular structure of 1-ethylquinolinium-4-carboxylate
fenfuram
Molecular structure of fenfuram
3-hydroxy-2-methyl-1-phenylpyridin-4-one
Molecular structure of 3-hydroxy-2-methyl-1-phenylpyridin-4-one
4,4'-iminobisphenol
Molecular structure of 4,4'-iminobisphenol
5-phenylmethylaminofurfural
Molecular structure of 5-phenylmethylaminofurfural