ethyl heptafluorobutyrate


ethyl heptafluorobutyrate; ethyl perfluorobutyrate
Links:📏 NIST
CAS:[356-27-4]
Formula:C6H5F7O2; 242.09 g/mol
InChiKey:JVHJRIQPDBCRRE-UHFFFAOYSA-N
SMILES:CCOC(=O)C(F)(F)C(F)(F)C(F)(F)F
Molecular structure of ethyl heptafluorobutyrate
Density:1.398 g/mL
Molar volume:173.2 mL/mol
Refractive index:1.302
Molecular refractive power:32.58 mL/mol
Dipole moment:3.09 D
Boiling point:95 °C

Isomers

ethyl heptafluorobutyrate
Molecular structure of ethyl heptafluorobutyrate
4,4,5,5,6,6,6-heptafluorohexanoic acid
Molecular structure of 4,4,5,5,6,6,6-heptafluorohexanoic acid