ethyl diazoacetate


diazoacetic acid ethyl ester; diazoacetic ester; diazoethyl acetate; ethyl diazoacetate; ethyl diazoethanoate
Links:🌍 Wikipedia, 📏 NIST, ⚗️ ChemSynthesis, 📖 PubMed
CAS:[623-73-4]
Formula:C4H6N2O2; 114.10 g/mol
InChiKey:YVPJCJLMRRTDMQ-UHFFFAOYSA-N
SMILES:CCOC(=O)C=[N+]=[N-]
Molecular structure of ethyl diazoacetate
Density:1.085 g/mL
Molar volume:105.1 mL/mol
Refractive index:1.459
Molecular refractive power:28.73 mL/mol
Dipole moment:2.03 D
Melting point:-22 °C
Boiling point:141 °C

Isomers

5,6-dihydrouracil
Molecular structure of 5,6-dihydrouracil
ethyl diazoacetate
Molecular structure of ethyl diazoacetate
1-methylhydantoin
Molecular structure of 1-methylhydantoin
5-methylhydantoin
Molecular structure of 5-methylhydantoin
muscimol
Molecular structure of muscimol
1-nitroso-2-pyrrolidinone
Molecular structure of 1-nitroso-2-pyrrolidinone
2,5-piperazinedione
Molecular structure of 2,5-piperazinedione