ethyl 4-chlorobenzoate


ethyl p-chlorobenzoate; ethyl 4-chlorobenzoate
CAS:[7335-27-5]
Formula:C9H9ClO2; 184.62 g/mol
InChiKey:RWBYCMPOFNRISR-UHFFFAOYSA-N
SMILES:CCOC(=O)c1ccc(Cl)cc1
Molecular structure of ethyl 4-chlorobenzoate
Density:1.181 g/mL
Molar volume:156.3 mL/mol
Refractive index:1.524
Molecular refractive power:47.83 mL/mol
Dipole moment:2.00 D
Boiling point:238 °C

Isomers

benzyloxyacetyl chloride
Molecular structure of benzyloxyacetyl chloride
4-chlorobenzyl acetate
Molecular structure of 4-chlorobenzyl acetate
2-chloroethyl benzoate
Molecular structure of 2-chloroethyl benzoate
4-(2-chloroethyl)benzoic acid
Molecular structure of 4-(2-chloroethyl)benzoic acid
1-(5-chloro-2-hydroxylphenyl)-1-propanone
Molecular structure of 1-(5-chloro-2-hydroxylphenyl)-1-propanone
5'-chloro-2'-hydroxy-4'-methylacetophenone
Molecular structure of 5'-chloro-2'-hydroxy-4'-methylacetophenone
3'-chloro-4'-methoxyacetophenone
Molecular structure of 3'-chloro-4'-methoxyacetophenone
2-chloromethyl-1,4-benzodioxane
Molecular structure of 2-chloromethyl-1,4-benzodioxane
4-(chloromethyl)phenyl acetate
Molecular structure of 4-(chloromethyl)phenyl acetate
4-chlorophenyl glycidyl ether
Molecular structure of 4-chlorophenyl glycidyl ether
2-(4-chlorophenyl)propanoic acid
Molecular structure of 2-(4-chlorophenyl)propanoic acid
3-(2-chlorophenyl)propanoic acid
Molecular structure of 3-(2-chlorophenyl)propanoic acid
3-(3-chlorophenyl)propanoic acid
Molecular structure of 3-(3-chlorophenyl)propanoic acid
3-(4-chlorophenyl)propanoic acid
Molecular structure of 3-(4-chlorophenyl)propanoic acid
3-(4-chlorophenyl)propionic acid
Molecular structure of 3-(4-chlorophenyl)propionic acid
2-ethoxybenzoyl chloride
Molecular structure of 2-ethoxybenzoyl chloride
4-ethoxybenzoyl chloride
Molecular structure of 4-ethoxybenzoyl chloride
ethyl 2-chlorobenzoate
Molecular structure of ethyl 2-chlorobenzoate
ethyl 3-chlorobenzoate
Molecular structure of ethyl 3-chlorobenzoate
ethyl 4-chlorobenzoate
Molecular structure of ethyl 4-chlorobenzoate
4'-methoxy-2-chloroacetophenone
Molecular structure of 4'-methoxy-2-chloroacetophenone
3-methoxyphenylacetyl chloride
Molecular structure of 3-methoxyphenylacetyl chloride
4-methoxyphenylacetyl chloride
Molecular structure of 4-methoxyphenylacetyl chloride
methyl 3-chloro-4-methylbenzoate
Molecular structure of methyl 3-chloro-4-methylbenzoate
methyl 4-(chloromethyl)benzoate
Molecular structure of methyl 4-(chloromethyl)benzoate
methyl 4-chloro-3-methylbenzoate
Molecular structure of methyl 4-chloro-3-methylbenzoate
2-phenoxypropionyl chloride
Molecular structure of 2-phenoxypropionyl chloride
phenylmethyl 2-chloroacetate
Molecular structure of phenylmethyl 2-chloroacetate