ethoxysilatrane


ethoxysilatrane; 5-ethoxy-4,6,11-trioxa-1-aza-5-silabicyclo[3.3.3]undecane
Links:📏 NIST, 🕷 ChemSpider, 📖 PubMed
CAS:[3463-21-6]
Formula:C8H17NO4Si; 219.31 g/mol
InChiKey:RAQAYUJGWWHPLN-UHFFFAOYSA-N
SMILES:CCO[Si]12OCCN(CCO1)CCO2
Molecular structure of ethoxysilatrane
Dipole moment:6.29 D