dodecafluoropentane


dodecafluoropentane; perflenapent; perfluoro-n-pentane; perfluoropentane
Links:📏 NIST, 📖 PubMed
MeSH:Contrast Media
CAS:[678-26-2]
Formula:C5F12; 288.04 g/mol
InChiKey:NJCBUSHGCBERSK-UHFFFAOYSA-N
SMILES:FC(F)(F)C(F)(F)C(F)(F)C(F)(F)C(F)(F)F
Molecular structure of dodecafluoropentane
Dipole moment:0.00 D
Melting point:-10 °C
Boiling point:30 °C
Critical temperature:149 °C
Critical pressure:2.0 atm
Log10 partition octanol / water:4.40

Isomers

dodecafluoropentane
Molecular structure of dodecafluoropentane
perfluoro-2,2-dimethylpropane
Molecular structure of perfluoro-2,2-dimethylpropane
perfluoro-2-methylbutane
Molecular structure of perfluoro-2-methylbutane