dodecafluorocyclohexane


dodecafluorocyclohexane; perfluorocyclohexane
Links:📏 NIST
CAS:[355-68-0]
Formula:C6F12; 300.05 g/mol
InChiKey:RKIMETXDACNTIE-UHFFFAOYSA-N
SMILES:FC1(F)C(F)(F)C(F)(F)C(F)(F)C(F)(F)C1(F)F
Molecular structure of dodecafluorocyclohexane
Dipole moment:0.00 D
Boiling point:53 °C
Critical temperature:184 °C
Critical pressure:2.4 atm
Log10 partition octanol / water:2.91

Isomers

dodecafluorocyclohexane
Molecular structure of dodecafluorocyclohexane
dodecafluorohex-1-ene
Molecular structure of dodecafluorohex-1-ene
nonafluoro-2-trifluoromethylpent-1-ene
Molecular structure of nonafluoro-2-trifluoromethylpent-1-ene
perfluoro(2-methyl-2-pentene)
Molecular structure of perfluoro(2-methyl-2-pentene)