divinyl quinoline-2,4-dicarboxylate


divinyl quinoline-2,4-dicarboxylate
Formula:C15H11NO4; 269.26 g/mol
InChiKey:YLPLLDYCIKPBEL-UHFFFAOYSA-N
SMILES:C=COC(=O)c1cc(C(=O)OC=C)c2ccccc2n1
Molecular structure of divinyl quinoline-2,4-dicarboxylate
Dipole moment:2.29 D

Isomers

2-benzoyl-3-(4-nitrophenyl)oxirane
Molecular structure of 2-benzoyl-3-(4-nitrophenyl)oxirane
divinyl quinoline-2,4-dicarboxylate
Molecular structure of divinyl quinoline-2,4-dicarboxylate
(2E)-1-(3-hydroxyphenyl)-3-(2-nitrophenyl)-2-propen-1-one
Molecular structure of (2E)-1-(3-hydroxyphenyl)-3-(2-nitrophenyl)-2-propen-1-one
methyl 2-methyl-5-oxo-5H-chromeno[4,3-β]pyridine-3-carboxylate
Molecular structure of methyl 2-methyl-5-oxo-5H-chromeno[4,3-b]pyridine-3-carboxylate
3-(4-nitrophenyl)-3,4-dihydro-1H-isochromen-1-one
Molecular structure of 3-(4-nitrophenyl)-3,4-dihydro-1H-isochromen-1-one
(2Z)-2-(2-nitrophenyl)-3-phenylprop-2-enoic acid
Molecular structure of (2Z)-2-(2-nitrophenyl)-3-phenylprop-2-enoic acid
(E)-2-(4-nitrophenyl)-3-phenylpropenoic acid
Molecular structure of (E)-2-(4-nitrophenyl)-3-phenylpropenoic acid
(Z)-2-(4-nitrophenyl)-3-phenylpropenoic acid
Molecular structure of (Z)-2-(4-nitrophenyl)-3-phenylpropenoic acid
(Z)-3-(4-nitrophenyl)-2-phenylpropenoic acid
Molecular structure of (Z)-3-(4-nitrophenyl)-2-phenylpropenoic acid
(E)-2-phenyl-3-(2-nitrophenyl)propenoic acid
Molecular structure of (E)-2-phenyl-3-(2-nitrophenyl)propenoic acid
(E)-2-phenyl-3-(3-nitrophenyl)propenoic acid
Molecular structure of (E)-2-phenyl-3-(3-nitrophenyl)propenoic acid
(E)-2-phenyl-3-(4-nitrophenyl)propenoic acid
Molecular structure of (E)-2-phenyl-3-(4-nitrophenyl)propenoic acid