dipropyl benzene-1,4-dicarboxylate


dipropyl benzene-1,4-dicarboxylate; dipropyl terephthalate
Links:📏 NIST, 🕷 ChemSpider
CAS:[1962-74-9]
Formula:C14H18O4; 250.29 g/mol
InChiKey:GXJPKIGCMGAHTL-UHFFFAOYSA-N
SMILES:CCCOC(=O)c1ccc(cc1)C(=O)OCCC
Molecular structure of dipropyl benzene-1,4-dicarboxylate
Dipole moment:2.44 D
Melting point:27 °C

Isomers

benzene-1,4-diyldiethane-2,1-diyl diacetate
Molecular structure of benzene-1,4-diyldiethane-2,1-diyl diacetate
benzyl tert-butyl malonate
Molecular structure of benzyl tert-butyl malonate
cinoxate
Molecular structure of cinoxate
diethyl benzylmalonate
Molecular structure of diethyl benzylmalonate
diethyl 2-(4-methylphenyl)propanedioate
Molecular structure of diethyl 2-(4-methylphenyl)propanedioate
diisopropyl phthalate
Molecular structure of diisopropyl phthalate
dipropyl benzene-1,2-dicarboxylate
Molecular structure of dipropyl benzene-1,2-dicarboxylate
dipropyl benzene-1,3-dicarboxylate
Molecular structure of dipropyl benzene-1,3-dicarboxylate
dipropyl benzene-1,4-dicarboxylate
Molecular structure of dipropyl benzene-1,4-dicarboxylate
ethyl methyl 2-ethyl-2-phenylpropanedioate
Molecular structure of ethyl methyl 2-ethyl-2-phenylpropanedioate
(R)-(+)-6-hydroxy-2,5,7,8-tetramethylchroman-2-carboxylic acid
Molecular structure of (R)-(+)-6-hydroxy-2,5,7,8-tetramethylchroman-2-carboxylic acid
(S)-(-)-6-hydroxy-2,5,7,8-tetramethylchroman-2-carboxylic acid
Molecular structure of (S)-(-)-6-hydroxy-2,5,7,8-tetramethylchroman-2-carboxylic acid
5-methoxy-4,4-dimethyl-5-oxo-3-phenylpentanoic acid
Molecular structure of 5-methoxy-4,4-dimethyl-5-oxo-3-phenylpentanoic acid
methyl 3-[3-(3-methoxy-3-oxopropyl)phenyl]propanoate
Molecular structure of methyl 3-[3-(3-methoxy-3-oxopropyl)phenyl]propanoate
trolox C
Molecular structure of trolox C