diphenylmethanethione


diphenylmethanethione; thiobenzophenone
Links:📏 NIST, 🕷 ChemSpider, ⚗️ ChemSynthesis, 📖 PubMed
CAS:[1450-31-3]
Formula:C13H10S; 198.29 g/mol
InChiKey:XDDVRYDDMGRFAZ-UHFFFAOYSA-N
SMILES:S=C(c1ccccc1)c2ccccc2
Molecular structure of diphenylmethanethione
Dipole moment:3.37 D
Melting point:54 °C

Isomers

diphenylmethanethione
Molecular structure of diphenylmethanethione
9H-thioxanthene
Molecular structure of 9H-thioxanthene