diphenylmethane


benzylbenzene; diphenylmethane; ditane; 1,1'-methylenebisbenzene; phenylmethylbenzene
Links:🌍 Wikipedia, 📏 NIST, 📖 PubMed,
📖Houben-Weyl, 2. Band (Diphenylmethan); p. 191, 231, 352, 419, 593, 602, 606, 638, 639, 645, 669, 908
CAS:[101-81-5]
Formula:C13H12; 168.24 g/mol
InChiKey:CZZYITDELCSZES-UHFFFAOYSA-N
SMILES:C(c1ccccc1)c2ccccc2
Molecular structure of diphenylmethane
Density:1.006 g/mL
Molar volume:167.2 mL/mol
Refractive index:1.575
Molecular refractive power:55.26 mL/mol
Dielectric constant:2.61
Dipole moment:0.26 D
Melting point:91 °C
Boiling point:263 °C
Antoine equation
P(Torr) vs T(°C)
Vapour pressure vs temperature
Critical pressure:2.7 atm
Log10 partition octanol / water:4.14
Hildebrant solubility parameter (δ):9.6

Isomers

1-allylnaphthalene
Molecular structure of 1-allylnaphthalene
1,2-cyclopentanonaphthalene
Molecular structure of 1,2-cyclopentanonaphthalene
2,3-cyclopentanonaphthalene
Molecular structure of 2,3-cyclopentanonaphthalene
2,3-dihydrophenalene
Molecular structure of 2,3-dihydrophenalene
diphenylmethane
Molecular structure of diphenylmethane
1-isopropenylnaphthalene
Molecular structure of 1-isopropenylnaphthalene
2-isopropenylnaphthalene
Molecular structure of 2-isopropenylnaphthalene
3-methylacenaphthene
Molecular structure of 3-methylacenaphthene
5-methylacenaphthene
Molecular structure of 5-methylacenaphthene
2-methylbiphenyl
Molecular structure of 2-methylbiphenyl
3-methylbiphenyl
Molecular structure of 3-methylbiphenyl
4-phenyltoluene
Molecular structure of 4-phenyltoluene
1-[(E)-propen-1-yl]naphthalene
Molecular structure of 1-[(E)-propen-1-yl]naphthalene