diphenyldifluorosilane


difluoro-di(phenyl)silane; difluoro-diphenylsilane; diphenyldifluorosilane
Links:📏 NIST
CAS:[312-40-3]
Formula:C12H10F2Si; 220.29 g/mol
InChiKey:BOMPXIHODLVNMC-UHFFFAOYSA-N
SMILES:F[Si](F)(c1ccccc1)c2ccccc2
Molecular structure of diphenyldifluorosilane
Dipole moment:2.59 D
Boiling point:253 °C
Antoine equation
P(Torr) vs T(°C)
Vapour pressure vs temperature