diphenyldichlorotin


dichloro-di(phenyl)stannane; dichloro-diphenylstannane; diphenyldichlorotin; diphenylstannic chloride; diphenyltin dichloride
CAS:[1135-99-5]
Formula:C12H10Cl2Sn; 343.83 g/mol
InChiKey:ISXUHJXWYNONDI-UHFFFAOYSA-L
SMILES:Cl[Sn](Cl)(c1ccccc1)c2ccccc2
Molecular structure of diphenyldichlorotin
Dipole moment:3.65 D
Melting point:42 °C
Boiling point:335 °C