diphenyldichlorosilane


dichloro(diphenyl)silane; dichloro-di(phenyl)silane; dichloro-diphenylsilane; dichlorodiphenylsilane; diphenyldichlorosilane
Links:📏 NIST, 📖 PubMed
CAS:[80-10-4]
Formula:C12H10Cl2Si; 253.20 g/mol
InChiKey:OSXYHAQZDCICNX-UHFFFAOYSA-N
SMILES:Cl[Si](Cl)(c1ccccc1)c2ccccc2
Molecular structure of diphenyldichlorosilane
Density:1.208 g/mL
Molar volume:209.6 mL/mol
Refractive index:1.579
Molecular refractive power:69.66 mL/mol
Dipole moment:2.58 D
Melting point:-22 °C
Boiling point:304 °C
Antoine equation
P(Torr) vs T(°C)
Vapour pressure vs temperature