diphenylacetonitrile


diphenylacetonitrile; diphenylcyanomethane
Links:⚗️ ChemSynthesis
CAS:[86-29-3]
Formula:C14H11N; 193.25 g/mol
InChiKey:NEBPTMCRLHKPOB-UHFFFAOYSA-N
SMILES:N#CC(c1ccccc1)c2ccccc2
Molecular structure of diphenylacetonitrile
Dipole moment:3.57 D
Melting point:74 °C

Isomers

2-aminoanthracene
Molecular structure of 2-aminoanthracene
1-aminophenanthrene
Molecular structure of 1-aminophenanthrene
2-aminophenanthrene
Molecular structure of 2-aminophenanthrene
3-aminophenanthrene
Molecular structure of 3-aminophenanthrene
9-aminophenanthrene
Molecular structure of 9-aminophenanthrene
1-anthracenamine
Molecular structure of 1-anthracenamine
11H-benzo[β][1]benzazepine
Molecular structure of 11H-benzo[b][1]benzazepine
4-biphenylacetonitrile
Molecular structure of 4-biphenylacetonitrile
2-cyano-4'-methylbiphenyl
Molecular structure of 2-cyano-4'-methylbiphenyl
diphenylacetonitrile
Molecular structure of diphenylacetonitrile
9-ethenyl-9H-carbazole
Molecular structure of 9-ethenyl-9H-carbazole
9-methylacridine
Molecular structure of 9-methylacridine
3-methylbenzo[f]quinoline
Molecular structure of 3-methylbenzo[f]quinoline
4-p-methylphenylethynylpyridine
Molecular structure of 4-p-methylphenylethynylpyridine
6-methyl-2-(phenylethynyl)pyridine
Molecular structure of 6-methyl-2-(phenylethynyl)pyridine
2-phenylindole
Molecular structure of 2-phenylindole
2-phenylindolizine
Molecular structure of 2-phenylindolizine
4-(phenylmethyl)benzonitrile
Molecular structure of 4-(phenylmethyl)benzonitrile