diphenyl sulfoxide


diphenyl sulfoxide; diphenyl sulphoxide; phenylsulfinylbenzene; phenylsulfinylbenzene; phenyl sulfoxide; 1,1'-sulfinylbisbenzene
Links:📏 NIST, 📖 PubMed,
📖Houben-Weyl, 2. Band (Diphenylsulfoxyd); p. 364
CAS:[945-51-7]
Formula:C12H10OS; 202.28 g/mol
InChiKey:JJHHIJFTHRNPIK-UHFFFAOYSA-N
SMILES:O=[S](c1ccccc1)c2ccccc2
Molecular structure of diphenyl sulfoxide
Dipole moment:4.08 D
Melting point:71 °C
Log10 partition octanol / water:2.06

Isomers

diphenyl sulfoxide
Molecular structure of diphenyl sulfoxide
2-methyl-6-phenyl-4H-pyran-4-thione
Molecular structure of 2-methyl-6-phenyl-4H-pyran-4-thione
4-phenylsulfanylphenol
Molecular structure of 4-phenylsulfanylphenol