diphenyl sulfone


diphenyl sulfone; diphenyl sulphone; phenyl sulfone; phenylsulfonylbenzene; 1,1'-sulfonyldibenzene
Links:🌍 Wikipedia, 📏 NIST, 📖 PubMed,
📖Houben-Weyl, 2. Band (Diphenylsulfon); p. 364
CAS:[127-63-9]
Formula:C12H10O2S; 218.28 g/mol
InChiKey:KZTYYGOKRVBIMI-UHFFFAOYSA-N
SMILES:O=[S](=O)(c1ccccc1)c2ccccc2
Molecular structure of diphenyl sulfone
Density:1.360 g/mL
Molar volume:160.5 mL/mol
Dipole moment:5.09 D
Melting point:128 °C
Boiling point:379 °C
Log10 partition octanol / water:2.40

Isomers

diphenyl sulfone
Molecular structure of diphenyl sulfone
(4-methoxyphenyl)-thiophen-2-ylmethanone
Molecular structure of (4-methoxyphenyl)-thiophen-2-ylmethanone
methyl 4-(3-thienyl)benzoate
Molecular structure of methyl 4-(3-thienyl)benzoate
4,4'-thiodiphenol
Molecular structure of 4,4'-thiodiphenol